C22H27NO3S — CID 55612776
N-(3-cyclopentylsulfonylphenyl)-3-(4-ethylphenyl)propanamide (PubChem CID 55612776) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-3-(4-ethylphenyl)propanamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-3-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 55612776 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-3-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(CCC(=O)Nc2cccc(S(=O)(=O)C3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-2-17-10-12-18(13-11-17)14-15-22(24)23-19-6-5-9-21(16-19)27(25,26)20-7-3-4-8-20/h5-6,9-13,16,20H,2-4,7-8,14-15H2,1H3,(H,23,24) |
| InChIKey | VIUGJYZVWMRVRS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |