C20H23ClN2O5S2 — CID 55636261
3-[(2-chlorophenyl)sulfonylamino]-N-(3-cyclopentylsulfonylphenyl)propanamide (PubChem CID 55636261) has the molecular formula C20H23ClN2O5S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-(3-cyclopentylsulfonylphenyl)propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-(3-cyclopentylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55636261 |
| Molecular Formula | C20H23ClN2O5S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-(3-cyclopentylsulfonylphenyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1Cl)Nc1cccc(S(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C20H23ClN2O5S2/c21-18-10-3-4-11-19(18)30(27,28)22-13-12-20(24)23-15-6-5-9-17(14-15)29(25,26)16-7-1-2-8-16/h3-6,9-11,14,16,22H,1-2,7-8,12-13H2,(H,23,24) |
| InChIKey | IPIVICZOJVIDSM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |