C22H20ClN3O4S — CID 55868550
N-[3-[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]phenyl]benzamide (PubChem CID 55868550) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is N-[3-[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]phenyl]benzamide.
| Compound Name | N-[3-[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 55868550 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[3-[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]phenyl]benzamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1Cl)Nc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H20ClN3O4S/c23-19-11-4-5-12-20(19)31(29,30)24-14-13-21(27)25-17-9-6-10-18(15-17)26-22(28)16-7-2-1-3-8-16/h1-12,15,24H,13-14H2,(H,25,27)(H,26,28) |
| InChIKey | ZYGPJOFFDCDQFW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |