C22H22ClN3O5S — CID 55682810
3-[(2-chlorophenyl)sulfonylamino]-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]propanamide (PubChem CID 55682810) has the molecular formula C22H22ClN3O5S and a molecular weight of 475.95 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 55682810 |
| Molecular Formula | C22H22ClN3O5S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]propanamide |
| SMILES | COc1ccc(NC(=O)CCNS(=O)(=O)c2ccccc2Cl)cc1OCc1ccncc1 |
| InChI | InChI=1S/C22H22ClN3O5S/c1-30-19-7-6-17(14-20(19)31-15-16-8-11-24-12-9-16)26-22(27)10-13-25-32(28,29)21-5-3-2-4-18(21)23/h2-9,11-12,14,25H,10,13,15H2,1H3,(H,26,27) |
| InChIKey | JPYHFRTURWSXQT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |