C18H23N3O3 — CID 119848510
N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-4-(methylamino)butanamide (PubChem CID 119848510) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119848510 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(OC)c(OCc2ccncc2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-19-9-3-4-18(22)21-15-5-6-16(23-2)17(12-15)24-13-14-7-10-20-11-8-14/h5-8,10-12,19H,3-4,9,13H2,1-2H3,(H,21,22) |
| InChIKey | CQZDSFSQEDRJOU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|