C20H29Cl2N3O3 — CID 119852198
N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119852198) has the molecular formula C20H29Cl2N3O3 and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119852198 |
| Molecular Formula | C20H29Cl2N3O3 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NC(C)c1ccc(OCc2ccncc2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C20H27N3O3.2ClH/c1-15(23-20(24)5-4-10-21-2)17-6-7-18(19(13-17)25-3)26-14-16-8-11-22-12-9-16;;/h6-9,11-13,15,21H,4-5,10,14H2,1-3H3,(H,23,24);2*1H |
| InChIKey | BTPSYDRSHQQUDC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|