C27H29N3O3S — CID 55806868
5-(1,3-benzothiazol-2-yl)-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]pentanamide (PubChem CID 55806868) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 55806868 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[1-[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]ethyl]pentanamide |
| SMILES | COc1cc(C(C)NC(=O)CCCCc2nc3ccccc3s2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-19(21-11-12-23(24(17-21)32-2)33-18-20-13-15-28-16-14-20)29-26(31)9-5-6-10-27-30-22-7-3-4-8-25(22)34-27/h3-4,7-8,11-17,19H,5-6,9-10,18H2,1-2H3,(H,29,31) |
| InChIKey | JRGKAOMSHQZBFQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|