C22H26N2O4S2 — CID 55748506
2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide (PubChem CID 55748506) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 55748506 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)CSCc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C22H26N2O4S2/c1-15(16-8-9-18(19(12-16)27-3)28-11-10-26-2)23-21(25)13-29-14-22-24-17-6-4-5-7-20(17)30-22/h4-9,12,15H,10-11,13-14H2,1-3H3,(H,23,25) |
| InChIKey | TZOJZIFMPGTHHJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|