C22H24F3N3O4 — CID 55797774
N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 55797774) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 55797774 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)Cn2c(C(F)(F)F)nc3ccccc32)cc1OC |
| InChI | InChI=1S/C22H24F3N3O4/c1-14(15-8-9-18(19(12-15)31-3)32-11-10-30-2)26-20(29)13-28-17-7-5-4-6-16(17)27-21(28)22(23,24)25/h4-9,12,14H,10-11,13H2,1-3H3,(H,26,29) |
| InChIKey | BNOTYNQLEUHMPM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|