C29H33N3O5 — CID 17010037
3,4-dimethoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17010037) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17010037 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 3,4-dimethoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(C)c2nc3ccccc3n2CCCCOc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C29H33N3O5/c1-20(30-29(33)21-15-16-25(35-3)27(19-21)36-4)28-31-22-11-5-6-12-23(22)32(28)17-9-10-18-37-26-14-8-7-13-24(26)34-2/h5-8,11-16,19-20H,9-10,17-18H2,1-4H3,(H,30,33) |
| InChIKey | UZTKNOCIZPMLNK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|