C25H27N3O3S — CID 16973684
N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 16973684) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16973684 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccccc1OCCCCn1c(C(C)NC(=O)c2cccs2)nc2ccccc21 |
| InChI | InChI=1S/C25H27N3O3S/c1-18(26-25(29)23-14-9-17-32-23)24-27-19-10-3-4-11-20(19)28(24)15-7-8-16-31-22-13-6-5-12-21(22)30-2/h3-6,9-14,17-18H,7-8,15-16H2,1-2H3,(H,26,29) |
| InChIKey | ZZRHOSXMBNLWTD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|