C18H21N3OS — CID 3243597
N-[1-(1-butylbenzimidazol-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 3243597) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[1-(1-butylbenzimidazol-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(1-butylbenzimidazol-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3243597 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[1-(1-butylbenzimidazol-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | CCCCn1c(C(C)NC(=O)c2cccs2)nc2ccccc21 |
| InChI | InChI=1S/C18H21N3OS/c1-3-4-11-21-15-9-6-5-8-14(15)20-17(21)13(2)19-18(22)16-10-7-12-23-16/h5-10,12-13H,3-4,11H2,1-2H3,(H,19,22) |
| InChIKey | LEMWNGVWPPJAJP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |