C28H31N3O4 — CID 16968045
2-methoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16968045) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-methoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-methoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16968045 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-methoxy-N-[1-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | COc1ccccc1OCCCCn1c(C(C)NC(=O)c2ccccc2OC)nc2ccccc21 |
| InChI | InChI=1S/C28H31N3O4/c1-20(29-28(32)21-12-4-7-15-24(21)33-2)27-30-22-13-5-6-14-23(22)31(27)18-10-11-19-35-26-17-9-8-16-25(26)34-3/h4-9,12-17,20H,10-11,18-19H2,1-3H3,(H,29,32) |
| InChIKey | ZVBUTVAWYYLOBZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|