C30H32BrN3O3 — CID 17009416
4-bromo-N-[1-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17009416) has the molecular formula C30H32BrN3O3 and a molecular weight of 562.51 g/mol. Its IUPAC name is 4-bromo-N-[1-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[1-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17009416 |
| Molecular Formula | C30H32BrN3O3 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 4-bromo-N-[1-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(C(C)NC(=O)c3ccc(Br)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C30H32BrN3O3/c1-4-9-22-12-17-27(28(20-22)36-3)37-19-8-7-18-34-26-11-6-5-10-25(26)33-29(34)21(2)32-30(35)23-13-15-24(31)16-14-23/h4-6,9-17,20-21H,7-8,18-19H2,1-3H3,(H,32,35)/b9-4+ |
| InChIKey | ISCVWMSHBPPSMP-RUDMXATFSA-N |
| XLogP | 7.19 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|