C25H33N3O3 — CID 17009937
N-[1-(1-heptylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 17009937) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[1-(1-heptylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(1-heptylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17009937 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[1-(1-heptylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | CCCCCCCn1c(C(C)NC(=O)c2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C25H33N3O3/c1-5-6-7-8-11-16-28-21-13-10-9-12-20(21)27-24(28)18(2)26-25(29)19-14-15-22(30-3)23(17-19)31-4/h9-10,12-15,17-18H,5-8,11,16H2,1-4H3,(H,26,29) |
| InChIKey | VCCZOYSSYJLRJG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|