C30H32ClN3O3 — CID 17009568
4-chloro-N-[1-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17009568) has the molecular formula C30H32ClN3O3 and a molecular weight of 518.06 g/mol. Its IUPAC name is 4-chloro-N-[1-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[1-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17009568 |
| Molecular Formula | C30H32ClN3O3 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 4-chloro-N-[1-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C=CCc1ccc(OCCCCn2c(C(C)NC(=O)c3ccc(Cl)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C30H32ClN3O3/c1-4-9-22-12-17-27(28(20-22)36-3)37-19-8-7-18-34-26-11-6-5-10-25(26)33-29(34)21(2)32-30(35)23-13-15-24(31)16-14-23/h4-6,10-17,20-21H,1,7-9,18-19H2,2-3H3,(H,32,35) |
| InChIKey | FZNWYGHCMZLUAI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|