C27H27ClN2O3 — CID 16998964
2-[1-(4-chlorophenoxy)ethyl]-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole (PubChem CID 16998964) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is 2-[1-(4-chlorophenoxy)ethyl]-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-[1-(4-chlorophenoxy)ethyl]-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16998964 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[1-(4-chlorophenoxy)ethyl]-1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazole |
| SMILES | C=CCc1ccc(OCCn2c(C(C)Oc3ccc(Cl)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C27H27ClN2O3/c1-4-7-20-10-15-25(26(18-20)31-3)32-17-16-30-24-9-6-5-8-23(24)29-27(30)19(2)33-22-13-11-21(28)12-14-22/h4-6,8-15,18-19H,1,7,16-17H2,2-3H3 |
| InChIKey | QAVKOQMRPRJXJZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|