C32H37N3O5 — CID 16972911
2-(3,4-dimethoxyphenyl)-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16972911) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16972911 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | C=CCc1ccc(OCCCn2c(C(C)NC(=O)Cc3ccc(OC)c(OC)c3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C32H37N3O5/c1-6-10-23-13-16-28(30(19-23)39-5)40-18-9-17-35-26-12-8-7-11-25(26)34-32(35)22(2)33-31(36)21-24-14-15-27(37-3)29(20-24)38-4/h6-8,11-16,19-20,22H,1,9-10,17-18,21H2,2-5H3,(H,33,36) |
| InChIKey | CILOESWBTHOASN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|