C24H27N3O3 — CID 16969998
N-[1-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]prop-2-enamide (PubChem CID 16969998) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[1-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]prop-2-enamide.
| Compound Name | N-[1-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 16969998 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[1-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
| SMILES | C=CCc1ccc(OCCn2c(C(C)NC(=O)C=C)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-5-9-18-12-13-21(22(16-18)29-4)30-15-14-27-20-11-8-7-10-19(20)26-24(27)17(3)25-23(28)6-2/h5-8,10-13,16-17H,1-2,9,14-15H2,3-4H3,(H,25,28) |
| InChIKey | YPIFUWPFZOCJDQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|