C28H37N3O3 — CID 16969084
2-ethyl-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]butanamide (PubChem CID 16969084) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-ethyl-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]butanamide.
| Compound Name | 2-ethyl-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 16969084 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 2-ethyl-N-[1-[1-[3-(2-methoxy-4-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]butanamide |
| SMILES | C=CCc1ccc(OCCCn2c(C(C)NC(=O)C(CC)CC)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C28H37N3O3/c1-6-12-21-15-16-25(26(19-21)33-5)34-18-11-17-31-24-14-10-9-13-23(24)30-27(31)20(4)29-28(32)22(7-2)8-3/h6,9-10,13-16,19-20,22H,1,7-8,11-12,17-18H2,2-5H3,(H,29,32) |
| InChIKey | OYNFVNLIFSPXKT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|