C25H31N3O3 — CID 18885701
N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylacetamide (PubChem CID 18885701) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylacetamide.
| Compound Name | N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 18885701 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]-N-methylacetamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CN(C)C(C)=O)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-5-10-20-13-14-23(24(17-20)30-4)31-16-9-8-15-28-22-12-7-6-11-21(22)26-25(28)18-27(3)19(2)29/h5-7,11-14,17H,1,8-10,15-16,18H2,2-4H3 |
| InChIKey | QBXHVESYYXTJSN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|