C26H35N3O2 — CID 16969089
N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide (PubChem CID 16969089) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide.
| Compound Name | N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 16969089 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NC(C)c1nc2ccccc2n1CCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-6-21(7-2)26(30)27-20(5)25-28-23-11-8-9-12-24(23)29(25)13-10-14-31-22-16-18(3)15-19(4)17-22/h8-9,11-12,15-17,20-21H,6-7,10,13-14H2,1-5H3,(H,27,30) |
| InChIKey | SDKOAVBNWUPIBL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|