C26H28N4O2 — CID 16965453
N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide (PubChem CID 16965453) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16965453 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[1-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C)cc(OCCCn2c(C(C)NC(=O)c3ccncc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C26H28N4O2/c1-18-15-19(2)17-22(16-18)32-14-6-13-30-24-8-5-4-7-23(24)29-25(30)20(3)28-26(31)21-9-11-27-12-10-21/h4-5,7-12,15-17,20H,6,13-14H2,1-3H3,(H,28,31) |
| InChIKey | KFCOMIHPCVGVQT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|