C28H29N3O2 — CID 16967385
N-[1-[1-[3-(2-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16967385) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[1-[1-[3-(2-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | N-[1-[1-[3-(2-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16967385 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[1-[1-[3-(2-prop-2-enylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C=CCc1ccccc1OCCCn1c(C(C)NC(=O)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C28H29N3O2/c1-3-12-22-13-7-10-18-26(22)33-20-11-19-31-25-17-9-8-16-24(25)30-27(31)21(2)29-28(32)23-14-5-4-6-15-23/h3-10,13-18,21H,1,11-12,19-20H2,2H3,(H,29,32) |
| InChIKey | YHPQVWGMHACDOT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|