C22H29NO6 — CID 55748572
N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide (PubChem CID 55748572) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide.
| Compound Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 55748572 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-2-(2-methoxy-4-methylphenoxy)acetamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)COc2ccc(C)cc2OC)cc1OC |
| InChI | InChI=1S/C22H29NO6/c1-15-6-8-19(20(12-15)26-4)29-14-22(24)23-16(2)17-7-9-18(21(13-17)27-5)28-11-10-25-3/h6-9,12-13,16H,10-11,14H2,1-5H3,(H,23,24) |
| InChIKey | NFZJWJUKDQIGAF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|