C21H26ClNO5 — CID 55748250
2-(4-chloro-3-methylphenoxy)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide (PubChem CID 55748250) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 55748250 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]acetamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)COc2ccc(Cl)c(C)c2)cc1OC |
| InChI | InChI=1S/C21H26ClNO5/c1-14-11-17(6-7-18(14)22)28-13-21(24)23-15(2)16-5-8-19(20(12-16)26-4)27-10-9-25-3/h5-8,11-12,15H,9-10,13H2,1-4H3,(H,23,24) |
| InChIKey | CUJUYEXZUSKKFA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|