C20H25NO5 — CID 71885691
N-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]-2-(3-methylphenoxy)acetamide (PubChem CID 71885691) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is N-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 71885691 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[1-[4-(2-hydroxyethoxy)-3-methoxyphenyl]ethyl]-2-(3-methylphenoxy)acetamide |
| SMILES | COc1cc(C(C)NC(=O)COc2cccc(C)c2)ccc1OCCO |
| InChI | InChI=1S/C20H25NO5/c1-14-5-4-6-17(11-14)26-13-20(23)21-15(2)16-7-8-18(25-10-9-22)19(12-16)24-3/h4-8,11-12,15,22H,9-10,13H2,1-3H3,(H,21,23) |
| InChIKey | YPBMHXRKYYMDPS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |