C15H16F3N3O3 — CID 119360208
(2S)-3-methyl-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]butanoic acid (PubChem CID 119360208) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119360208 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2S)-3-methyl-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)Cn1c(C(F)(F)F)nc2ccccc21)C(=O)O |
| InChI | InChI=1S/C15H16F3N3O3/c1-8(2)12(13(23)24)20-11(22)7-21-10-6-4-3-5-9(10)19-14(21)15(16,17)18/h3-6,8,12H,7H2,1-2H3,(H,20,22)(H,23,24)/t12-/m0/s1 |
| InChIKey | AYAUMZMJXSNYEF-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |