C14H15F3N4O — CID 7043891
N'-but-1-en-2-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide (PubChem CID 7043891) has the molecular formula C14H15F3N4O and a molecular weight of 312.30 g/mol. Its IUPAC name is N'-but-1-en-2-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide.
| Compound Name | N'-but-1-en-2-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 7043891 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N'-but-1-en-2-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide |
| SMILES | C=C(CC)NNC(=O)Cn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C14H15F3N4O/c1-3-9(2)19-20-12(22)8-21-11-7-5-4-6-10(11)18-13(21)14(15,16)17/h4-7,19H,2-3,8H2,1H3,(H,20,22) |
| InChIKey | XEHFYAPTGXYTKH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|