C20H19F3N4O3 — CID 27568841
N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide (PubChem CID 27568841) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 27568841 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)Cn2c(C(F)(F)F)nc3ccccc32)c1 |
| InChI | InChI=1S/C20H19F3N4O3/c1-12-7-8-13(2)16(9-12)30-11-18(29)26-25-17(28)10-27-15-6-4-3-5-14(15)24-19(27)20(21,22)23/h3-9H,10-11H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | VVVMREBJBMSLRT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|