C16H17F3N4O3 — CID 35804088
N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetohydrazide (PubChem CID 35804088) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 35804088 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)Cn2ccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C16H17F3N4O3/c1-10-3-4-11(2)12(7-10)26-9-15(25)21-20-14(24)8-23-6-5-13(22-23)16(17,18)19/h3-7H,8-9H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | LOBNZGPUWVNLOU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|