C14H12F5N3O2 — CID 19530895
N-[2-(difluoromethoxy)-5-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19530895) has the molecular formula C14H12F5N3O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[2-(difluoromethoxy)-5-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19530895 |
| Molecular Formula | C14H12F5N3O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methylphenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1ccc(OC(F)F)c(NC(=O)Cn2ccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C14H12F5N3O2/c1-8-2-3-10(24-13(15)16)9(6-8)20-12(23)7-22-5-4-11(21-22)14(17,18)19/h2-6,13H,7H2,1H3,(H,20,23) |
| InChIKey | FSEXPVNTLSHCBU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |