C14H15F3N4O2S — CID 9418328
5-ethyl-4-methyl-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]thiophene-2-carbohydrazide (PubChem CID 9418328) has the molecular formula C14H15F3N4O2S and a molecular weight of 360.36 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9418328 |
| Molecular Formula | C14H15F3N4O2S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-ethyl-4-methyl-N'-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)Cn2ccc(C(F)(F)F)n2)cc1C |
| InChI | InChI=1S/C14H15F3N4O2S/c1-3-9-8(2)6-10(24-9)13(23)19-18-12(22)7-21-5-4-11(20-21)14(15,16)17/h4-6H,3,7H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | TUUFCBXCYRTKBW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|