C13H17N5O2S2 — CID 47093609
5-ethyl-4-methyl-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 47093609) has the molecular formula C13H17N5O2S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 47093609 |
| Molecular Formula | C13H17N5O2S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 5-ethyl-4-methyl-N'-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)CSc2nncn2C)cc1C |
| InChI | InChI=1S/C13H17N5O2S2/c1-4-9-8(2)5-10(22-9)12(20)16-15-11(19)6-21-13-17-14-7-18(13)3/h5,7H,4,6H2,1-3H3,(H,15,19)(H,16,20) |
| InChIKey | MWOKKJXDEHPJBS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|