C19H19N3O4S — CID 9418418
N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide (PubChem CID 9418418) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9418418 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)CCN2C(=O)c3ccccc3C2=O)cc1C |
| InChI | InChI=1S/C19H19N3O4S/c1-3-14-11(2)10-15(27-14)17(24)21-20-16(23)8-9-22-18(25)12-6-4-5-7-13(12)19(22)26/h4-7,10H,3,8-9H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | QLPJVKBFWWSZBN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|