C17H24N4O4S — CID 46523932
N'-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide (PubChem CID 46523932) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is N'-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 46523932 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N'-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)CN2C(=O)NC(CC)(CC)C2=O)cc1C |
| InChI | InChI=1S/C17H24N4O4S/c1-5-11-10(4)8-12(26-11)14(23)20-19-13(22)9-21-15(24)17(6-2,7-3)18-16(21)25/h8H,5-7,9H2,1-4H3,(H,18,25)(H,19,22)(H,20,23) |
| InChIKey | DKRYFRQQUVASIB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|