C14H20N4O3S — CID 51151070
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide (PubChem CID 51151070) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 51151070 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2nc(C)c(C)s2)C1=O |
| InChI | InChI=1S/C14H20N4O3S/c1-5-14(6-2)11(20)18(13(21)17-14)7-10(19)16-12-15-8(3)9(4)22-12/h5-7H2,1-4H3,(H,17,21)(H,15,16,19) |
| InChIKey | AELVOFYOOARQFJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|