C11H13N3OS — CID 110688639
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-pyrrol-1-ylacetamide (PubChem CID 110688639) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-pyrrol-1-ylacetamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-pyrrol-1-ylacetamide |
|---|---|
| PubChem CID | 110688639 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-pyrrol-1-ylacetamide |
| SMILES | Cc1nc(NC(=O)Cn2cccc2)sc1C |
| InChI | InChI=1S/C11H13N3OS/c1-8-9(2)16-11(12-8)13-10(15)7-14-5-3-4-6-14/h3-6H,7H2,1-2H3,(H,12,13,15) |
| InChIKey | HQOLWIXUZZOHCQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |