C10H16N2OS — CID 5181179
N-(4,5-dimethyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 5181179) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 5181179 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | CCCCC(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H16N2OS/c1-4-5-6-9(13)12-10-11-7(2)8(3)14-10/h4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | ZVDTUSGNBGRTKM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |