C9H14N2O2S — CID 79193438
N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-hydroxybutanamide (PubChem CID 79193438) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-hydroxybutanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 79193438 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-hydroxybutanamide |
| SMILES | Cc1nc(NC(=O)CCCO)sc1C |
| InChI | InChI=1S/C9H14N2O2S/c1-6-7(2)14-9(10-6)11-8(13)4-3-5-12/h12H,3-5H2,1-2H3,(H,10,11,13) |
| InChIKey | XTKQGSORRHYWFG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |