C17H22N2O2S — CID 19184081
N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(4-ethylphenoxy)butanamide (PubChem CID 19184081) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(4-ethylphenoxy)butanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(4-ethylphenoxy)butanamide |
|---|---|
| PubChem CID | 19184081 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(4-ethylphenoxy)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)Nc2nc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-4-14-7-9-15(10-8-14)21-11-5-6-16(20)19-17-18-12(2)13(3)22-17/h7-10H,4-6,11H2,1-3H3,(H,18,19,20) |
| InChIKey | UVXIPSLKZZKRQU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|