C21H21BrN2O2S — CID 19218771
N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(4-methylphenoxy)butanamide (PubChem CID 19218771) has the molecular formula C21H21BrN2O2S and a molecular weight of 445.38 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 19218771 |
| Molecular Formula | C21H21BrN2O2S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)Nc2nc(-c3ccc(Br)cc3)c(C)s2)cc1 |
| InChI | InChI=1S/C21H21BrN2O2S/c1-14-5-11-18(12-6-14)26-13-3-4-19(25)23-21-24-20(15(2)27-21)16-7-9-17(22)10-8-16/h5-12H,3-4,13H2,1-2H3,(H,23,24,25) |
| InChIKey | VZUVTIZWKIGZBR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|