C23H33N3O2S — CID 108750889
4-(4-ethylphenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 108750889) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is 4-(4-ethylphenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(4-ethylphenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108750889 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-(4-ethylphenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | CCc1ccc(OCCCC(=O)Nc2nc(C)c(CN3CCC(C)CC3)s2)cc1 |
| InChI | InChI=1S/C23H33N3O2S/c1-4-19-7-9-20(10-8-19)28-15-5-6-22(27)25-23-24-18(3)21(29-23)16-26-13-11-17(2)12-14-26/h7-10,17H,4-6,11-16H2,1-3H3,(H,24,25,27) |
| InChIKey | JPVDWYBBCDNRNG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|