C28H37N3O2S — CID 108760850
4-(4-tert-butylphenoxy)-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]butanamide (PubChem CID 108760850) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108760850 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[6-[(4-methylpiperidin-1-yl)methyl]-1,3-benzothiazol-2-yl]butanamide |
| SMILES | CC1CCN(Cc2ccc3nc(NC(=O)CCCOc4ccc(C(C)(C)C)cc4)sc3c2)CC1 |
| InChI | InChI=1S/C28H37N3O2S/c1-20-13-15-31(16-14-20)19-21-7-12-24-25(18-21)34-27(29-24)30-26(32)6-5-17-33-23-10-8-22(9-11-23)28(2,3)4/h7-12,18,20H,5-6,13-17,19H2,1-4H3,(H,29,30,32) |
| InChIKey | FNTIXRVRORZDOK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|