C24H28N2O4S — CID 108761948
ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 108761948) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 108761948 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | ethyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)CCCOc3ccc(C(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C24H28N2O4S/c1-5-29-22(28)16-8-13-19-20(15-16)31-23(25-19)26-21(27)7-6-14-30-18-11-9-17(10-12-18)24(2,3)4/h8-13,15H,5-7,14H2,1-4H3,(H,25,26,27) |
| InChIKey | SMTXLBLDFSXYJJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|