C20H20N2O3S — CID 2547257
4-(4-acetylphenoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 2547257) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2547257 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-13-5-10-17-18(12-13)26-20(21-17)22-19(24)4-3-11-25-16-8-6-15(7-9-16)14(2)23/h5-10,12H,3-4,11H2,1-2H3,(H,21,22,24) |
| InChIKey | UTNQCMLHVIMQEP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|