C14H17ClN2O3S — CID 17244938
4-chloro-N-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]butanamide (PubChem CID 17244938) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 4-chloro-N-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | 4-chloro-N-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 17244938 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-chloro-N-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]butanamide |
| SMILES | COCCOc1ccc2nc(NC(=O)CCCCl)sc2c1 |
| InChI | InChI=1S/C14H17ClN2O3S/c1-19-7-8-20-10-4-5-11-12(9-10)21-14(16-11)17-13(18)3-2-6-15/h4-5,9H,2-3,6-8H2,1H3,(H,16,17,18) |
| InChIKey | DRRHAXMAGZMFIO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|