C15H18N2O3S — CID 29246675
ethyl 2-(3-methylbutanoylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 29246675) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 2-(3-methylbutanoylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(3-methylbutanoylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 29246675 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 2-(3-methylbutanoylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)CC(C)C)sc2c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-4-20-14(19)10-5-6-11-12(8-10)21-15(16-11)17-13(18)7-9(2)3/h5-6,8-9H,4,7H2,1-3H3,(H,16,17,18) |
| InChIKey | JWBVJEFMTVQGFI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |