C22H25N3O4S — CID 2072077
4-[4-(2-methylbutan-2-yl)phenoxy]-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 2072077) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-[4-(2-methylbutan-2-yl)phenoxy]-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-[4-(2-methylbutan-2-yl)phenoxy]-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2072077 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[4-(2-methylbutan-2-yl)phenoxy]-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-4-22(2,3)15-7-10-17(11-8-15)29-13-5-6-20(26)24-21-23-18-12-9-16(25(27)28)14-19(18)30-21/h7-12,14H,4-6,13H2,1-3H3,(H,23,24,26) |
| InChIKey | HHEOIJBTLSVIKC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|