C12H12BrN3O3S — CID 107908064
5-bromo-N-(6-nitro-1,3-benzothiazol-2-yl)pentanamide (PubChem CID 107908064) has the molecular formula C12H12BrN3O3S and a molecular weight of 358.22 g/mol. Its IUPAC name is 5-bromo-N-(6-nitro-1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | 5-bromo-N-(6-nitro-1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 107908064 |
| Molecular Formula | C12H12BrN3O3S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 5-bromo-N-(6-nitro-1,3-benzothiazol-2-yl)pentanamide |
| SMILES | O=C(CCCCBr)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C12H12BrN3O3S/c13-6-2-1-3-11(17)15-12-14-9-5-4-8(16(18)19)7-10(9)20-12/h4-5,7H,1-3,6H2,(H,14,15,17) |
| InChIKey | JSICHUXBWNUVBO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|